![2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoic acid (CAS: 96-84-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0746953.png "2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoic acid chemical structure")
2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoic acid
Catalog No: FT-0746953
CAS No: 96-84-4
- Chemical Name: 2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoic acid
- Molecular Formula: C11H11I3O3
- Molecular Weight: 571.92
- InChI Key: GOIQOQCNFWYSTQ-UHFFFAOYSA-N
- InChI: InChI=1S/C11H11I3O3/c1-2-5(11(16)17)3-6-7(12)4-8(13)10(15)9(6)14/h4-5,15H,2-3H2,1H3,(H,16,17)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 459ºC at 760mmHg |
|---|---|
| Symbol: | GHS07 |
| MF: | C11H11I3O3 |
| Melting_Point: | 146-148ºC(lit.) |
| Flash_Point: | 231.4ºC |
| Product_Name: | 2-[(3-hydroxy-2,4,6-triiodophenyl)methyl]butanoic acid |
| FW: | 571.91700 |
| CAS: | 96-84-4 |
| Density: | 2.471g/cm3 |
| PSA: | 57.53000 |
|---|---|
| Refractive_Index: | 1.724 |
| Bolling_Point: | 459ºC at 760mmHg |
| FW: | 571.91700 |
| Melting_Point: | 146-148ºC(lit.) |
| LogP: | 3.85930 |
| Exact_Mass: | 571.78400 |
| MF: | C11H11I3O3 |
| Computational_Chemistry: | ['1. XlogP :42 ', '2. Hydrogen Bond Donor Count :2 ', '3. Hydrogen Bond Acceptor Count :3 ', '4. Rotatable Bond Count :4 ', '5. Isotope Atom Count :6 ', '6. TPSA 575 ', '7. Heavy Atom Count :17 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :275 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :1 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Flash_Point: | 231.4ºC |
| Density: | 2.471g/cm3 |
| Safety_Statements: | S36 |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Hazard_Codes: | Xn: Harmful; |
| Symbol: | GHS07 |
| RTECS: | MW5280000 |
| HS_Code: | 2918199090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Risk_Statements(EU): | 22-36/37/38 |
| RIDADR: | NONH for all modes of transport |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.png "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.png "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
